What is the PubChem CID of the compound Amiridin?
The PubChem CID of Amiridin is 6437859.
What is the molecular formula of Amiridin?
The molecular formula of Amiridin is C12H17ClN2.
What are the synonyms of Amiridin?
The synonyms of Amiridin include Ipidacrine hydrochloride, 90043-86-0, and 2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-amine hydrochloride.
What is the molecular weight of Amiridin?
The molecular weight of Amiridin is 224.73 g/mol.
What is the parent compound of Amiridin?
The parent compound of Amiridin is Ipidacrine (CID 604519).
What are the two component compounds of Amiridin?
The two component compounds of Amiridin are Ipidacrine (CID 604519) and hydrochloric acid (CID 313).
What is the IUPAC name of Amiridin?
The IUPAC name of Amiridin is 2,3,5,6,7,8-hexahydro-1H-cyclopenta[b]quinolin-9-amine;hydrochloride.
What is the InChI of Amiridin?
The InChI of Amiridin is InChI=1S/C12H16N2.ClH/c13-12-8-4-1-2-6-10(8)14-11-7-3-5-9(11)12;/h1-7H2,(H2,13,14);1H.
What is the Canonical SMILES of Amiridin?
The Canonical SMILES of Amiridin is C1CCC2=C(C1)C(=C3CCCC3=N2)N.Cl.
What is the CAS number of Amiridin?
The CAS number of Amiridin is 90043-86-0.