What is the PubChem CID for Phenylboronic acid?
The PubChem CID for Phenylboronic acid is 66827.
What is the molecular formula of Phenylboronic acid?
The molecular formula of Phenylboronic acid is C6H7BO2.
What is the molecular weight of Phenylboronic acid?
The molecular weight of Phenylboronic acid is 121.93 g/mol.
What is the IUPAC name of Phenylboronic acid?
The IUPAC name of Phenylboronic acid is phenylboronic acid.
What is the InChI of Phenylboronic acid?
The InChI of Phenylboronic acid is InChI=1S/C6H7BO2/c8-7(9)6-4-2-1-3-5-6/h1-5,8-9H.
What is the InChIKey of Phenylboronic acid?
The InChIKey of Phenylboronic acid is HXITXNWTGFUOAU-UHFFFAOYSA-N.
What is the canonical SMILES of Phenylboronic acid?
The canonical SMILES of Phenylboronic acid is B(C1=CC=CC=C1)(O)O.
What is the CAS number of Phenylboronic acid?
The CAS number of Phenylboronic acid is 98-80-6.
What is the ChEMBL ID of Phenylboronic acid?
The ChEMBL ID of Phenylboronic acid is CHEMBL21485.
What is the Hydrogen Bond Donor Count of Phenylboronic acid?
The Hydrogen Bond Donor Count of Phenylboronic acid is 2.
Download
