What is the PubChem CID of M-toluic acid?
PubChem CID 7418.
What is the molecular formula of M-toluic acid?
The molecular formula of M-toluic acid is C8H8O2.
What is the molecular weight of M-toluic acid?
The molecular weight of M-toluic acid is 136.15 g/mol.
What is the IUPAC name of M-toluic acid?
The IUPAC name of M-toluic acid is 3-methylbenzoic acid.
What is the InChI of M-toluic acid?
The InChI of M-toluic acid is InChI=1S/C8H8O2/c1-6-3-2-4-7(5-6)8(9)10/h2-5H,1H3,(H,9,10).
What is the InChIKey of M-toluic acid?
The InChIKey of M-toluic acid is GPSDUZXPYCFOSQ-UHFFFAOYSA-N.
What is the CAS number of M-toluic acid?
The CAS number of M-toluic acid is 99-04-7.
What is the XLogP3 value of M-toluic acid?
The XLogP3 value of M-toluic acid is 2.4.
How many hydrogen bond donor counts does M-toluic acid have?
M-toluic acid has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does M-toluic acid have?
M-toluic acid has 2 hydrogen bond acceptor counts.