CAS
89998-14-1 Purity
---
89998-14-1 Purity
---
Shopping basket
Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.l]nonane
CAS
89999-86-0
Catalog Number
ACM89999860
Category
Other Products
Molecular Weight
262.28
Molecular Formula
C14H28BO.K
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
The molecular formula is C14H27BKO.
What is the molecular weight of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
The molecular weight is 261.27 g/mol.
When was Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane created?
It was created on January 8, 2016.
What are the component compounds of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
The component compounds are Potassium and CID 102600929.
What is the Canonical SMILES representation of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
[B-]1(C2CCCC1CCC2)OC(C)(C)C(C)C.[K+]
How many hydrogen bond acceptor counts does Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane have?
It has 2 hydrogen bond acceptor counts.
What is the exact mass of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
The exact mass is 261.1792021 g/mol.
What is the topological polar surface area of Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane?
The topological polar surface area is 9.2 Ų.
How many heavy atoms does Potassium 9-(2,3-dimethyl-2-butoxy)-9-boratabicyclo[3.3.1]nonane contain?
It contains 17 heavy atoms.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![9-(1,1,2-Trimethylpropoxy)-9-borabicyclo[3.3.1]nonane](https://resource.alfa-chemistry.com/structure/89999-87-1.gif)
