What is the molecular formula of Quinazolin-7-ylboronic acid?
The molecular formula of Quinazolin-7-ylboronic acid is C8H7BN2O2.
What are the synonyms for Quinazolin-7-ylboronic acid?
The synonyms for Quinazolin-7-ylboronic acid are QUINAZOLIN-7-YLBORONIC ACID, 899438-46-1, Boronic acid, 7-quinazolinyl-, and QUINAZOLIN-7-BORONIC ACID.
What is the molecular weight of Quinazolin-7-ylboronic acid?
The molecular weight of Quinazolin-7-ylboronic acid is 173.97 g/mol.
What is the IUPAC Name of Quinazolin-7-ylboronic acid?
The IUPAC Name of Quinazolin-7-ylboronic acid is quinazolin-7-ylboronic acid.
What is the InChI of Quinazolin-7-ylboronic acid?
The InChI of Quinazolin-7-ylboronic acid is InChI=1S/C8H7BN2O2/c12-9(13)7-2-1-6-4-10-5-11-8(6)3-7/h1-5,12-13H.
What is the InChIKey of Quinazolin-7-ylboronic acid?
The InChIKey of Quinazolin-7-ylboronic acid is WAPOSZXCZRHKGA-UHFFFAOYSA-N.
What is the Canonical SMILES of Quinazolin-7-ylboronic acid?
The Canonical SMILES of Quinazolin-7-ylboronic acid is B(C1=CC2=NC=NC=C2C=C1)(O)O.
What is the CAS number of Quinazolin-7-ylboronic acid?
The CAS number of Quinazolin-7-ylboronic acid is 899438-46-1.
Is Quinazolin-7-ylboronic acid a canonicalized compound?
Yes, Quinazolin-7-ylboronic acid is a canonicalized compound.
※ Please kindly note that our products are for research use only.