What is the molecular formula of cicletanine?
The molecular formula of cicletanine is C14H12ClNO2.
What is the molecular weight of cicletanine?
The molecular weight of cicletanine is 261.70 g/mol.
What is the IUPAC name of cicletanine?
The IUPAC name of cicletanine is 3-(4-chlorophenyl)-6-methyl-1,3-dihydrofuro[3,4-c]pyridin-7-ol.
What is the InChI of cicletanine?
The InChI of cicletanine is InChI=1S/C14H12ClNO2/c1-8-13(17)12-7-18-14(11(12)6-16-8)9-2-4-10(15)5-3-9/h2-6,14,17H,7H2,1H3.
What is the InChIKey of cicletanine?
The InChIKey of cicletanine is CVKNDPRBJVBDSS-UHFFFAOYSA-N.
What is the Canonical SMILES of cicletanine?
The Canonical SMILES of cicletanine is CC1=NC=C2C(OCC2=C1O)C3=CC=C(C=C3)Cl.
What is the CAS number of cicletanine?
The CAS number of cicletanine is 89943-82-8.
What is the ChEMBL ID of cicletanine?
The ChEMBL ID of cicletanine is CHEMBL191886.
What is the Hydrogen Bond Acceptor Count of cicletanine?
The Hydrogen Bond Acceptor Count of cicletanine is 3.
What is the Topological Polar Surface Area of cicletanine?
The Topological Polar Surface Area of cicletanine is 42.4?2.