CAS
89886-42-0 Purity
96%
89886-42-0 Purity
96%
Shopping basket
Sodium acetylacetonate hydrate
CAS
89891-03-4
Catalog Number
ACM89891034
Category
Other Products
Molecular Formula
C5H7NaO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of sodium acetylacetonate hydrate?
The molecular formula of sodium acetylacetonate hydrate is C5H7NaO2.
What is the molecular weight of sodium acetylacetonate hydrate?
The molecular weight of sodium acetylacetonate hydrate is 122.10 g/mol.
What is the IUPAC name of sodium acetylacetonate hydrate?
The IUPAC name of sodium acetylacetonate hydrate is sodium;(Z)-4-oxopent-2-en-2-olate.
What is the InChI of sodium acetylacetonate hydrate?
The InChI of sodium acetylacetonate hydrate is InChI=1S/C5H8O2.Na/c1-4(6)3-5(2)7;/h3,6H,1-2H3;/q;+1/p-1/b4-3-.
What is the InChIKey of sodium acetylacetonate hydrate?
The InChIKey of sodium acetylacetonate hydrate is AIWZOHBYSFSQGV-LNKPDPKZSA-M.
What is the canonical SMILES of sodium acetylacetonate hydrate?
The canonical SMILES of sodium acetylacetonate hydrate is CC(=CC(=O)C)[O-].[Na+].
What is the isomeric SMILES of sodium acetylacetonate hydrate?
The isomeric SMILES of sodium acetylacetonate hydrate is C/C(=C/C(=O)C)/[O-].[Na+].
What is the hydrogen bond donor count of sodium acetylacetonate hydrate?
The hydrogen bond donor count of sodium acetylacetonate hydrate is 0.
What is the hydrogen bond acceptor count of sodium acetylacetonate hydrate?
The hydrogen bond acceptor count of sodium acetylacetonate hydrate is 2.
What is the topological polar surface area of sodium acetylacetonate hydrate?
The topological polar surface area of sodium acetylacetonate hydrate is 40.1 ?2.
Recommended Products
![3-Bromo-N-[(3-bromopropanoylamino)methyl]propanamide](https://resource.alfa-chemistry.com/structure/89891-40-7.gif)
