What is the molecular formula of Cyclobutyl 3,4-dichlorophenyl ketone?
The molecular formula is C11H10Cl2O.
When was Cyclobutyl 3,4-dichlorophenyl ketone created and modified in PubChem?
It was created on 2008-02-29 and modified on 2023-12-30.
What is the IUPAC name of Cyclobutyl 3,4-dichlorophenyl ketone?
The IUPAC name is cyclobutyl-(3,4-dichlorophenyl)methanone.
What is the InChI of Cyclobutyl 3,4-dichlorophenyl ketone?
The InChI is InChI=1S/C11H10Cl2O/c12-9-5-4-8(6-10(9)13)11(14)7-2-1-3-7/h4-7H,1-3H2.
What is the InChIKey of Cyclobutyl 3,4-dichlorophenyl ketone?
The InChIKey is IWXVLJAVZHYAAF-UHFFFAOYSA-N.
How many hydrogen bond donor counts does Cyclobutyl 3,4-dichlorophenyl ketone have?
It has 0 hydrogen bond donor counts.
What is the XLogP3-AA value of Cyclobutyl 3,4-dichlorophenyl ketone?
The XLogP3-AA value is 3.9.
What is the topological polar surface area of Cyclobutyl 3,4-dichlorophenyl ketone?
The topological polar surface area is 17.1 Ų.
Is Cyclobutyl 3,4-dichlorophenyl ketone a canonicalized compound?
Yes, it is a canonicalized compound.
How many defined atom stereocenter counts does Cyclobutyl 3,4-dichlorophenyl ketone have?
It has 0 defined atom stereocenter counts.