What is the molecular formula of 1-Chloro-2-ethylbenzene?
The molecular formula of 1-Chloro-2-ethylbenzene is C8H9Cl.
How much does 1-Chloro-2-ethylbenzene weigh?
The molecular weight of 1-Chloro-2-ethylbenzene is 140.61 g/mol.
What is the IUPAC name of 1-Chloro-2-ethylbenzene?
The IUPAC name of 1-Chloro-2-ethylbenzene is 1-chloro-2-ethylbenzene.
What is the InChI code of 1-Chloro-2-ethylbenzene?
The InChI code of 1-Chloro-2-ethylbenzene is InChI=1S/C8H9Cl/c1-2-7-5-3-4-6-8(7)9/h3-6H,2H2,1H3.
What is the InChIKey of 1-Chloro-2-ethylbenzene?
The InChIKey of 1-Chloro-2-ethylbenzene is CVGAWKYSRYXQOI-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Chloro-2-ethylbenzene?
The canonical SMILES of 1-Chloro-2-ethylbenzene is CCC1=CC=CC=C1Cl.
What is the CAS number of 1-Chloro-2-ethylbenzene?
The CAS number of 1-Chloro-2-ethylbenzene is 89-96-3.
How many hydrogen bond donor count does 1-Chloro-2-ethylbenzene have?
1-Chloro-2-ethylbenzene has 0 hydrogen bond donor count.
How many rotatable bond count does 1-Chloro-2-ethylbenzene have?
1-Chloro-2-ethylbenzene has 1 rotatable bond count.
Is 1-Chloro-2-ethylbenzene a covalently-bonded unit?
Yes, 1-Chloro-2-ethylbenzene is a covalently-bonded unit.