What is the molecular formula of O-Desmethyl Pyrilamine?
The molecular formula of O-Desmethyl Pyrilamine is C16H21N3O.
What are the synonyms for O-Desmethyl Pyrilamine?
The synonyms for O-Desmethyl Pyrilamine are Phenol, 4-[[[2-(dimethylamino)ethyl]-2-pyridinylamino]methyl]- and PHENOL, 4-(((2-(DIMETHYLAMINO)ETHYL)-2-PYRIDINYLAMINO)METHYL)-.
What is the molecular weight of O-Desmethyl Pyrilamine?
The molecular weight of O-Desmethyl Pyrilamine is 271.36 g/mol.
When was O-Desmethyl Pyrilamine created and modified?
O-Desmethyl Pyrilamine was created on 2007-02-09 and modified on 2023-10-21.
What is the IUPAC name of O-Desmethyl Pyrilamine?
The IUPAC name of O-Desmethyl Pyrilamine is 4-[[2-(dimethylamino)ethyl-pyridin-2-ylamino]methyl]phenol.
What is the InChI of O-Desmethyl Pyrilamine?
The InChI of O-Desmethyl Pyrilamine is InChI=1S/C16H21N3O/c1-18(2)11-12-19(16-5-3-4-10-17-16)13-14-6-8-15(20)9-7-14/h3-10,20H,11-13H2,1-2H3.
What is the InChIKey of O-Desmethyl Pyrilamine?
The InChIKey of O-Desmethyl Pyrilamine is FCFBHFOEKQWQBR-UHFFFAOYSA-N.
What is the canonical SMILES of O-Desmethyl Pyrilamine?
The canonical SMILES of O-Desmethyl Pyrilamine is CN(C)CCN(CC1=CC=C(C=C1)O)C2=CC=CC=N2.
What is the CAS number of O-Desmethyl Pyrilamine?
The CAS number of O-Desmethyl Pyrilamine is 57830-29-2.
What is the ChEMBL ID of O-Desmethyl Pyrilamine?
The ChEMBL ID of O-Desmethyl Pyrilamine is CHEMBL3544794.