What is the molecular formula of hexamethylene bis-hydroxystearamide?
The molecular formula of hexamethylene bis-hydroxystearamide is C42H84N2O4.
What is the structure of hexamethylene bis-hydroxystearamide?
The structure of hexamethylene bis-hydroxystearamide can be viewed at the following link: [Link].
What is the molecular weight of hexamethylene bis-hydroxystearamide?
The molecular weight of hexamethylene bis-hydroxystearamide is 681.1 g/mol.
What is the CAS number of hexamethylene bis-hydroxystearamide?
The CAS number of hexamethylene bis-hydroxystearamide is 55349-01-4.
What is the IUPAC name of hexamethylene bis-hydroxystearamide?
The IUPAC name of hexamethylene bis-hydroxystearamide is 12-hydroxy-N-[6-(12-hydroxyoctadecanoylamino)hexyl]octadecanamide.
What is the InChI of hexamethylene bis-hydroxystearamide?
The InChI of hexamethylene bis-hydroxystearamide is InChI=1S/C42H84N2O4/c1-3-5-7-23-31-39(45)33-25-17-13-9-11-15-19-27-35-41(47)43-37-29-21-22-30-38-44-42(48)36-28-20-16-12-10-14-18-26-34-40(46)32-24-8-6-4-2/h39-40,45-46H,3-38H2,1-2H3,(H,43,47)(H,44,48).
What is the InChIKey of hexamethylene bis-hydroxystearamide?
The InChIKey of hexamethylene bis-hydroxystearamide is CXPIOTOKMJNFSA-UHFFFAOYSA-N.
What are the other identifiers of hexamethylene bis-hydroxystearamide?
The other identifiers of hexamethylene bis-hydroxystearamide include CAS number 55349-01-4, UNII 2FS31BFC0F, and DSSTox Substance ID DTXSID9052214.
What is the XLogP3-AA value of hexamethylene bis-hydroxystearamide?
The XLogP3-AA value of hexamethylene bis-hydroxystearamide is 13.3.
What is the physical description of hexamethylene bis-hydroxystearamide?
Hexamethylene bis-hydroxystearamide is described as a dry powder.
※ Please kindly note that our products are for research use only.