What is the molecular formula of stictic acid?
The molecular formula of stictic acid is C19H14O9.
What is the molecular weight of stictic acid?
The molecular weight of stictic acid is 386.3 g/mol.
What are the synonyms for stictic acid?
The synonyms for stictic acid include NSC-87511, NSC87511, NZR6AX77LP, and more.
Where is stictic acid found?
Stictic acid is found in Cetraria aculeata, Dimelaena oreina, and other organisms.
What is the IUPAC name of stictic acid?
The IUPAC name of stictic acid is 13,17-dihydroxy-5-methoxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.03,8.014,18]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carbaldehyde.
What is the InChI of stictic acid?
The InChI of stictic acid is InChI=1S/C19H14O9/c1-6-4-9(25-3)8(5-20)15-10(6)17(22)27-14-7(2)13(21)11-12(16(14)26-15)19(24)28-18(11)23/h4-5,19,21,24H,1-3H3.
What is the InChIKey of stictic acid?
The InChIKey of stictic acid is SKCUFZLDTAYNBZ-UHFFFAOYSA-N.
What is the canonical SMILES of stictic acid?
The canonical SMILES of stictic acid is CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3C)O)C(=O)OC4O)C=O)OC.
What is the CAS number of stictic acid?
The CAS number of stictic acid is 549-06-4.
What is the hydrogen bond donor count of stictic acid?
The hydrogen bond donor count of stictic acid is 2.