What is the molecular formula of methanetrisulphonic acid?
The molecular formula of methanetrisulphonic acid is CH4O9S3.
What are some synonyms for methanetrisulphonic acid?
Some synonyms for methanetrisulphonic acid are methanetrisulfonic acid and Methanetrisulphonic acid.
What is the PubChem CID for methanetrisulphonic acid?
The PubChem CID for methanetrisulphonic acid is 108576.
What is the molecular weight of methanetrisulphonic acid?
The molecular weight of methanetrisulphonic acid is 256.2 g/mol.
When was methanetrisulphonic acid created?
Methanetrisulphonic acid was created on March 26, 2005.
What is the IUPAC Name of methanetrisulphonic acid?
The IUPAC Name of methanetrisulphonic acid is methanetrisulfonic acid.
What is the InChI of methanetrisulphonic acid?
The InChI of methanetrisulphonic acid is InChI=1S/CH4O9S3/c2-11(3,4)1(12(5,6)7)13(8,9)10/h1H,(H,2,3,4)(H,5,6,7)(H,8,9,10).
What is the Canonical SMILES of methanetrisulphonic acid?
The Canonical SMILES of methanetrisulphonic acid is C(S(=O)(=O)O)(S(=O)(=O)O)S(=O)(=O)O.
What is the CAS number for methanetrisulphonic acid?
The CAS number for methanetrisulphonic acid is 54322-33-7.
What is the XLogP3-AA value of methanetrisulphonic acid?
The XLogP3-AA value of methanetrisulphonic acid is -2.9.