What is the molecular formula of Quinoline Hydrochloride?
The molecular formula of Quinoline Hydrochloride is C9H8ClN.
What is the molecular weight of Quinoline Hydrochloride?
The molecular weight of Quinoline Hydrochloride is 165.62 g/mol.
What are the synonyms for Quinoline Hydrochloride?
The synonyms for Quinoline Hydrochloride are Quinolinium chloride and Quinoline, hydrochloride.
What is the IUPAC name of Quinoline Hydrochloride?
The IUPAC name of Quinoline Hydrochloride is "quinoline;hydrochloride".
What is the InChI of Quinoline Hydrochloride?
The InChI of Quinoline Hydrochloride is "InChI=1S/C9H7N.ClH/c1-2-6-9-8(4-1)5-3-7-10-9;/h1-7H;1H".
What is the InChIKey of Quinoline Hydrochloride?
The InChIKey of Quinoline Hydrochloride is "PSXRWZBTVAZNSF-UHFFFAOYSA-N".
What is the CAS number of Quinoline Hydrochloride?
The CAS number of Quinoline Hydrochloride is 530-64-3.
What is the molecular weight calculated by PubChem for Quinoline Hydrochloride?
The molecular weight calculated by PubChem for Quinoline Hydrochloride is 165.62 g/mol.
How many hydrogen bond donor counts are there in Quinoline Hydrochloride?
There is one hydrogen bond donor count in Quinoline Hydrochloride.
How many rotatable bond counts are there in Quinoline Hydrochloride?
There are no rotatable bond counts in Quinoline Hydrochloride.