What is the molecular formula of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The molecular formula is C6H12O3.
What is the molecular weight of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The molecular weight is 132.16 g/mol.
What are the synonyms for (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The synonyms are L-ISOLEUCIC ACID, 51576-04-6, 9R3ZO89OD8, and 2S-hydroxy-3S-methylpentanoic acid.
What is the IUPAC name of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The IUPAC name is (2S,3S)-2-hydroxy-3-methylpentanoic acid.
What is the InChI of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The InChI is InChI=1S/C6H12O3/c1-3-4(2)5(7)6(8)9/h4-5,7H,3H2,1-2H3,(H,8,9)/t4-,5-/m0/s1.
What is the InChIKey of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The InChIKey is RILPIWOPNGRASR-WHFBIAKZSA-N.
What is the canonical SMILES of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The canonical SMILES is CCC(C)C(C(=O)O)O.
What is the CAS number of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The CAS number is 51576-04-6.
What is the XLogP3-AA value of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The XLogP3-AA value is 0.9.
What is the topological polar surface area of (2S,3S)-2-Hydroxy-3-methyl-pentanoic acid?
The topological polar surface area is 57.5Ų.