What is the molecular formula of (-)-Isoproterenol?
The molecular formula of (-)-Isoproterenol is C11H17NO3.
What is the molecular weight of (-)-Isoproterenol?
The molecular weight of (-)-Isoproterenol is 211.26 g/mol.
What is the IUPAC name of (-)-Isoproterenol?
The IUPAC name of (-)-Isoproterenol is 4-[(1R)-1-hydroxy-2-(propan-2-ylamino)ethyl]benzene-1,2-diol.
What is the InChI of (-)-Isoproterenol?
The InChI of (-)-Isoproterenol is InChI=1S/C11H17NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,11-15H,6H2,1-2H3/t11-/m0/s1.
What is the InChIKey of (-)-Isoproterenol?
The InChIKey of (-)-Isoproterenol is JWZZKOKVBUJMES-NSHDSACASA-N.
What is the canonical SMILES of (-)-Isoproterenol?
The canonical SMILES of (-)-Isoproterenol is CC(C)NCC(C1=CC(=C(C=C1)O)O)O.
What is the CAS number of (-)-Isoproterenol?
The CAS number of (-)-Isoproterenol is 51-31-0.
What is the hydrogen bond donor count of (-)-Isoproterenol?
The hydrogen bond donor count of (-)-Isoproterenol is 4.
What is the hydrogen bond acceptor count of (-)-Isoproterenol?
The hydrogen bond acceptor count of (-)-Isoproterenol is not mentioned in the reference.
What is the topological polar surface area of (-)-Isoproterenol?
The topological polar surface area of (-)-Isoproterenol is 72.7Ų.