What is the molecular formula of N,N,N'-Trimethyl-1,3-propanediamine?
The molecular formula of N,N,N'-Trimethyl-1,3-propanediamine is C6H16N2.
How is N,N,N'-Trimethyl-1,3-propanediamine also known by its IUPAC name?
N,N,N'-Trimethyl-1,3-propanediamine is also known as N,N',N'-trimethylpropane-1,3-diamine.
What is the molecular weight of N,N,N'-Trimethyl-1,3-propanediamine?
The molecular weight of N,N,N'-Trimethyl-1,3-propanediamine is 116.20 g/mol.
Can you provide the InChI of N,N,N'-Trimethyl-1,3-propanediamine?
The InChI of N,N,N'-Trimethyl-1,3-propanediamine is InChI=1S/C6H16N2/c1-7-5-4-6-8(2)3/h7H,4-6H2,1-3H3.
How many hydrogen bond donor counts are there in N,N,N'-Trimethyl-1,3-propanediamine?
There is 1 hydrogen bond donor count in N,N,N'-Trimethyl-1,3-propanediamine.
How many hydrogen bond acceptor counts are there in N,N,N'-Trimethyl-1,3-propanediamine?
There are 2 hydrogen bond acceptor counts in N,N,N'-Trimethyl-1,3-propanediamine.
How many rotatable bond counts are there in N,N,N'-Trimethyl-1,3-propanediamine?
There are 4 rotatable bond counts in N,N,N'-Trimethyl-1,3-propanediamine.
What is the exact mass of N,N,N'-Trimethyl-1,3-propanediamine?
The exact mass of N,N,N'-Trimethyl-1,3-propanediamine is 116.131348519 g/mol.
What is the topological polar surface area of N,N,N'-Trimethyl-1,3-propanediamine?
The topological polar surface area of N,N,N'-Trimethyl-1,3-propanediamine is 15.3Ų.
How many heavy atoms are there in N,N,N'-Trimethyl-1,3-propanediamine?
There are 8 heavy atoms in N,N,N'-Trimethyl-1,3-propanediamine.