What is the molecular formula of 2-Fluoroacrylic Acid?
The molecular formula of 2-Fluoroacrylic Acid is C3H3FO2.
What are the synonyms of 2-Fluoroacrylic Acid?
The synonyms of 2-Fluoroacrylic Acid are 2-fluoropropenoic acid, 2-fluoroprop-2-enoic Acid, and alpha-Fluoroacrylic acid.
What is the molecular weight of 2-Fluoroacrylic Acid?
The molecular weight of 2-Fluoroacrylic Acid is 90.05 g/mol.
What is the IUPAC name of 2-Fluoroacrylic Acid?
The IUPAC name of 2-Fluoroacrylic Acid is 2-fluoroprop-2-enoic acid.
What is the InChI of 2-Fluoroacrylic Acid?
The InChI of 2-Fluoroacrylic Acid is InChI=1S/C3H3FO2/c1-2(4)3(5)6/h1H2,(H,5,6).
What is the InChIKey of 2-Fluoroacrylic Acid?
The InChIKey of 2-Fluoroacrylic Acid is TYCFGHUTYSLISP-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Fluoroacrylic Acid?
The canonical SMILES of 2-Fluoroacrylic Acid is C=C(C(=O)O)F.
What is the CAS number of 2-Fluoroacrylic Acid?
The CAS number of 2-Fluoroacrylic Acid is 430-99-9.
What is the European Community (EC) Number of 2-Fluoroacrylic Acid?
The European Community (EC) Number of 2-Fluoroacrylic Acid is 692-468-3.
What is the UNII of 2-Fluoroacrylic Acid?
The UNII of 2-Fluoroacrylic Acid is BEP1A791CI.