What is the molecular formula of Viramidine Hydrochloride?
The molecular formula of Viramidine Hydrochloride is C8H14ClN5O4.
What are the synonyms for Viramidine Hydrochloride?
The synonyms for Viramidine Hydrochloride are Taribavirin hydrochloride, Taribavirin HCl, and Viramidine.
What is the molecular weight of Viramidine Hydrochloride?
The molecular weight of Viramidine Hydrochloride is 279.68 g/mol.
What is the parent compound of Viramidine Hydrochloride?
The parent compound of Viramidine Hydrochloride is Taribavirin.
What is the description of Viramidine Hydrochloride?
Viramidine Hydrochloride is a hydrochloride salt form of taribavirin, a prodrug of ribavirin that has activity against a wide range of viruses, including the hepatitis C virus and influenza virus.
What is the IUPAC name of Viramidine Hydrochloride?
The IUPAC name of Viramidine Hydrochloride is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboximidamide hydrochloride.
What is the InChIKey of Viramidine Hydrochloride?
The InChIKey of Viramidine Hydrochloride is PIGYMBULXKLTCJ-UHSSARMYSA-N.
What is the canonical SMILES of Viramidine Hydrochloride?
The canonical SMILES of Viramidine Hydrochloride is C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=N)N.Cl.
What is the CAS number of Viramidine Hydrochloride?
The CAS number of Viramidine Hydrochloride is 40372-00-7.
What is the hydrogen bond donor count of Viramidine Hydrochloride?
The hydrogen bond donor count of Viramidine Hydrochloride is 6.
Download
