What is the molecular formula of 1-Phenyl-tetrahydrocarboline?
The molecular formula of 1-Phenyl-tetrahydrocarboline is C17H16N2.
What are the synonyms of 1-Phenyl-tetrahydrocarboline?
The synonyms of 1-Phenyl-tetrahydrocarboline include 1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole and 1-Phenyl-2,3,4,9-tetrahydro-1H-beta-carboline.
What is the molecular weight of 1-Phenyl-tetrahydrocarboline?
The molecular weight of 1-Phenyl-tetrahydrocarboline is 248.32 g/mol.
When was 1-Phenyl-tetrahydrocarboline created?
1-Phenyl-tetrahydrocarboline was created on March 27, 2005.
When was 1-Phenyl-tetrahydrocarboline last modified?
1-Phenyl-tetrahydrocarboline was last modified on October 21, 2023.
What is the IUPAC name of 1-Phenyl-tetrahydrocarboline?
The IUPAC name of 1-Phenyl-tetrahydrocarboline is 1-phenyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole.
What is the InChI of 1-Phenyl-tetrahydrocarboline?
The InChI of 1-Phenyl-tetrahydrocarboline is InChI=1S/C17H16N2/c1-2-6-12(7-3-1)16-17-14(10-11-18-16)13-8-4-5-9-15(13)19-17/h1-9,16,18-19H,10-11H2.
What is the InChIKey of 1-Phenyl-tetrahydrocarboline?
The InChIKey of 1-Phenyl-tetrahydrocarboline is INERHEQVAVQJBO-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Phenyl-tetrahydrocarboline?
The Canonical SMILES of 1-Phenyl-tetrahydrocarboline is C1CNC(C2=C1C3=CC=CC=C3N2)C4=CC=CC=C4.
What is the CAS number of 1-Phenyl-tetrahydrocarboline?
The CAS number of 1-Phenyl-tetrahydrocarboline is 3790-45-2.
※ Please kindly note that our products are for research use only.