What is the molecular formula of (E)-non-2-enoic acid?
The molecular formula is C9H16O2.
What are the synonyms of (E)-non-2-enoic acid?
The synonyms are 2-Nonenoic acid, (E)-Non-2-enoic acid, trans-2-Nonenoic acid, and Nonylenic acid.
What is the molecular weight of (E)-non-2-enoic acid?
The molecular weight is 156.22 g/mol.
What is the IUPAC name of (E)-non-2-enoic acid?
The IUPAC name is (E)-non-2-enoic acid.
What is the InChI of (E)-non-2-enoic acid?
The InChI is InChI=1S/C9H16O2/c1-2-3-4-5-6-7-8-9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/b8-7+.
What is the InChIKey of (E)-non-2-enoic acid?
The InChIKey is ADLXTJMPCFOTOO-BQYQJAHWSA-N.
What is the canonical SMILES of (E)-non-2-enoic acid?
The canonical SMILES is CCCCCCC=CC(=O)O.
What are some other identifiers of (E)-non-2-enoic acid?
Other identifiers include CAS numbers (14812-03-4, 3760-11-0, 29830-11-3), European Community (EC) numbers (249-885-7, 223-171-5, 695-405-8), UNII (93232CN67V), JECFA number (1380), FEMA number (3954), DSSTox Substance ID (DTXSID8063171), Nikkaji number (J98.028E, J98.029C), Wikidata (Q27271549), and Metabolomics Workbench ID (853).
What is the XLogP3-AA value of (E)-non-2-enoic acid?
The XLogP3-AA value is 3.2.
What are the chemical and physical properties of (E)-non-2-enoic acid?
The chemical and physical properties include a molecular weight of 156.22 g/mol and an XLogP3-AA value of 3.2.