What is the molecular formula of hexahydrohippurate?
The molecular formula of hexahydrohippurate is C9H15NO3.
What are the synonyms for hexahydrohippurate?
The synonyms for hexahydrohippurate are Hexahydrohippurate, 32377-88-1, (Cyclohexanecarbonyl-amino)-acetic acid, hexahydrohippuric acid, and 2-(cyclohexanecarboxamido)acetic acid.
What is the molecular weight of hexahydrohippurate?
The molecular weight of hexahydrohippurate is 185.22 g/mol.
What is the IUPAC Name of hexahydrohippurate?
The IUPAC Name of hexahydrohippurate is 2-(cyclohexanecarbonylamino)acetic acid.
What is the InChI of hexahydrohippurate?
The InChI of hexahydrohippurate is InChI=1S/C9H15NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h7H,1-6H2,(H,10,13)(H,11,12).
What is the InChIKey of hexahydrohippurate?
The InChIKey of hexahydrohippurate is ROXXNENGCGLRSW-UHFFFAOYSA-N.
What is the canonical SMILES of hexahydrohippurate?
The canonical SMILES of hexahydrohippurate is C1CCC(CC1)C(=O)NCC(=O)O.
What is the CAS number of hexahydrohippurate?
The CAS number of hexahydrohippurate is 32377-88-1.
What is the UNII of hexahydrohippurate?
The UNII of hexahydrohippurate is 8QEB8PUK0Y.
What is the topological polar surface area of hexahydrohippurate?
The topological polar surface area of hexahydrohippurate is 66.4 Ų.
※ Please kindly note that our products are for research use only.