What is the melting point of Cesium tetraphenylborate?
It is greater than 400℃.
What is the molecular weight of Cesium tetraphenylborate?
It is 452.132 g/mol.
What are the storage conditions of Cesium tetraphenylborate？
It needs to be stored in a closed, cool and dry place.
What is the stability of Cesium tetraphenylborate?
Stored in a cool and closed place according to the regulations, it will not decompose and is relatively stable.
What is the molecular formula of Cesium tetraphenylborate?
The molecular formula of Cesium tetraphenylborate is C24H20BCs.
What is the main application of Cesium tetraphenylborate?
As a boric acid metal compound, Cesium tetraphenylborate is a very useful catalyst with high chemical catalytic efficiency.
What is the EC number of Cesium tetraphenylborate?
The EC number of Cesium tetraphenylborate is 623-620-9.
What is the synthesis of Cesium tetraphenylborate?
Cesium tetraphenylborate can be synthesized efficiently by one-pot method with format reagent, lithium reagent and sodium borohydride/alcohol solvent.
What canonical SMILES of Cesium tetraphenylborate?
It is [B-](C1=CC=CC=C1)(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4[Cs+].
What are the special applications of Cesium tetraphenylborate?
Cesium tetraphenylborate is a reactant, which can have π and σ modes, and is a complex of alkali metal [C6F5Xe]+salt.
Download
