What is the molecular formula of dicyclohexyltindibromide?
The molecular formula of dicyclohexyltindibromide is C12H22Br2Sn.
What is the molecular weight of dicyclohexyltindibromide?
The molecular weight of dicyclohexyltindibromide is 444.82 g/mol.
What is the IUPAC name of dicyclohexyltindibromide?
The IUPAC name of dicyclohexyltindibromide is dibromo(dicyclohexyl)stannane.
What is the InChI of dicyclohexyltindibromide?
The InChI of dicyclohexyltindibromide is InChI=1S/2C6H11.2BrH.Sn/c2*1-2-4-6-5-3-1;;;/h2*1H,2-6H2;2*1H;/q;;;;+2/p-2.
What is the InChIKey of dicyclohexyltindibromide?
The InChIKey of dicyclohexyltindibromide is RHFTTZVNBAHQBF-UHFFFAOYSA-L.
What is the canonical SMILES of dicyclohexyltindibromide?
The canonical SMILES of dicyclohexyltindibromide is C1CCC(CC1)[Sn](C2CCCCC2)(Br)Br.
What is the CAS number of dicyclohexyltindibromide?
The CAS number of dicyclohexyltindibromide is 2954-94-1.
What is the DSSTox Substance ID of dicyclohexyltindibromide?
The DSSTox Substance ID of dicyclohexyltindibromide is DTXSID40183725.
How many hydrogen bond donor counts does dicyclohexyltindibromide have?
Dicyclohexyltindibromide has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does dicyclohexyltindibromide have?
Dicyclohexyltindibromide has 0 hydrogen bond acceptor counts.
Download
