What is the molecular formula of diisodecylphenylphosphite (PDDP)?
The molecular formula of diisodecylphenylphosphite (PDDP) is C26H47O3P.
What are the synonyms of diisodecylphenylphosphite?
The synonyms of diisodecylphenylphosphite are Diisodecyl phenyl phosphite, bis(8-methylnonyl) phenyl phosphite, and Phosphorous acid, diisodecyl phenyl ester.
What is the molecular weight of diisodecylphenylphosphite?
The molecular weight of diisodecylphenylphosphite is 438.6 g/mol.
When was diisodecylphenylphosphite created?
Diisodecylphenylphosphite was created on July 12, 2007.
What is the IUPAC name of diisodecylphenylphosphite?
The IUPAC name of diisodecylphenylphosphite is bis(8-methylnonyl) phenyl phosphite.
What is the InChI key of diisodecylphenylphosphite?
The InChI key of diisodecylphenylphosphite is SXXILWLQSQDLDL-UHFFFAOYSA-N.
What is the canonical SMILES of diisodecylphenylphosphite?
The canonical SMILES of diisodecylphenylphosphite is CC(C)CCCCCCCOP(OCCCCCCCC(C)C)OC1=CC=CC=C1.
What is the CAS number of diisodecylphenylphosphite?
The CAS number of diisodecylphenylphosphite is 25550-98-5.
How many hydrogen bond acceptor counts does diisodecylphenylphosphite have?
Diisodecylphenylphosphite has 3 hydrogen bond acceptor counts.
Is diisodecylphenylphosphite a dry powder or a liquid?
Diisodecylphenylphosphite can exist as both a dry powder and a liquid.
※ Please kindly note that our products are for research use only.
Download
![2,2'-[Methylenebis(oxy)]bisethanol](https://resource.alfa-chemistry.com/structure/2565-36-8.gif)
