What is the molecular formula of Tris(2-ethylhexyl) borate?
The molecular formula of Tris(2-ethylhexyl) borate is C24H51BO3.
What are some synonyms for Tris(2-ethylhexyl) borate?
Some synonyms for Tris(2-ethylhexyl) borate include Tri(2-ethylhexyl) borate, 2-Ethylhexyl borate, and BORIC ACID, TRIS(2-ETHYLHEXYL) ESTER.
What is the molecular weight of Tris(2-ethylhexyl) borate?
The molecular weight of Tris(2-ethylhexyl) borate is 398.5 g/mol.
What is the IUPAC name of Tris(2-ethylhexyl) borate?
The IUPAC name of Tris(2-ethylhexyl) borate is tris(2-ethylhexyl) borate.
What is the InChI of Tris(2-ethylhexyl) borate?
The InChI of Tris(2-ethylhexyl) borate is InChI=1S/C24H51BO3/c1-7-13-16-22(10-4)19-26-25(27-20-23(11-5)17-14-8-2)28-21-24(12-6)18-15-9-3/h22-24H,7-21H2,1-6H3.
What is the InChIKey of Tris(2-ethylhexyl) borate?
The InChIKey of Tris(2-ethylhexyl) borate is DLVYHYUFIXLWKV-UHFFFAOYSA-N.
What is the Canonical SMILES of Tris(2-ethylhexyl) borate?
The Canonical SMILES of Tris(2-ethylhexyl) borate is B(OCC(CC)CCCC)(OCC(CC)CCCC)OCC(CC)CCCC.
What is the CAS number of Tris(2-ethylhexyl) borate?
The CAS number of Tris(2-ethylhexyl) borate is 2467-13-2.
What is the EC (European Community) number of Tris(2-ethylhexyl) borate?
The EC number of Tris(2-ethylhexyl) borate is 219-581-9.
What is the hydrogen bond acceptor count of Tris(2-ethylhexyl) borate?
The hydrogen bond acceptor count of Tris(2-ethylhexyl) borate is 3.
※ Please kindly note that our products are for research use only.