What is the molecular formula of 2-Cyano-2-phenylbutanoic acid methyl ester?
The molecular formula of 2-Cyano-2-phenylbutanoic acid methyl ester is C12H13NO2.
What are the synonyms for 2-Cyano-2-phenylbutanoic acid methyl ester?
The synonyms for 2-Cyano-2-phenylbutanoic acid methyl ester include methyl 2-cyano-2-phenylbutanoate and 2-phenyl-2-ethyl-2-cyanoacetic acid methyl ester.
What is the molecular weight of 2-Cyano-2-phenylbutanoic acid methyl ester?
The molecular weight of 2-Cyano-2-phenylbutanoic acid methyl ester is 203.24 g/mol.
What is the IUPAC name of 2-Cyano-2-phenylbutanoic acid methyl ester?
The IUPAC name of 2-Cyano-2-phenylbutanoic acid methyl ester is methyl 2-cyano-2-phenylbutanoate.
What is the InChI of 2-Cyano-2-phenylbutanoic acid methyl ester?
The InChI of 2-Cyano-2-phenylbutanoic acid methyl ester is InChI=1S/C12H13NO2/c1-3-12(9-13,11(14)15-2)10-7-5-4-6-8-10/h4-8H,3H2,1-2H3.
What is the InChIKey of 2-Cyano-2-phenylbutanoic acid methyl ester?
The InChIKey of 2-Cyano-2-phenylbutanoic acid methyl ester is QCQKFMJKGAXAMV-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Cyano-2-phenylbutanoic acid methyl ester?
The canonical SMILES of 2-Cyano-2-phenylbutanoic acid methyl ester is CCC(C#N)(C1=CC=CC=C1)C(=O)OC.
What is the CAS number for 2-Cyano-2-phenylbutanoic acid methyl ester?
The CAS number for 2-Cyano-2-phenylbutanoic acid methyl ester is 24131-07-5.
How many hydrogen bond acceptor counts does 2-Cyano-2-phenylbutanoic acid methyl ester have?
2-Cyano-2-phenylbutanoic acid methyl ester has 3 hydrogen bond acceptor counts.
Is 2-Cyano-2-phenylbutanoic acid methyl ester a canonicalized compound?
Yes, 2-Cyano-2-phenylbutanoic acid methyl ester is a canonicalized compound.
※ Please kindly note that our products are for research use only.