What is the molecular formula of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The molecular formula is C24H26O3.
What are the synonyms for Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The synonyms are 2300-15-4, 2,4-Bis(1-(4-hydroxyphenyl)isopropyl)phenol, 2,4-bis[1-(4-hydroxyphenyl)isopropyl]phenol, 4,4'-((4-hydroxy-1,3-phenylene)bis(propane-2,2-diyl))diphenol.
What is the molecular weight of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The molecular weight is 362.5 g/mol.
When was Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl] created and modified?
It was created on March 27, 2005, and modified on October 21, 2023.
What is the IUPAC name of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The IUPAC name is 2,4-bis[2-(4-hydroxyphenyl)propan-2-yl]phenol.
What is the InChI of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The InChI is InChI=1S/C24H26O3/c1-23(2,16-5-10-19(25)11-6-16)18-9-14-22(27)21(15-18)24(3,4)17-7-12-20(26)13-8-17/h5-15,25-27H,1-4H3.
What is the InChIKey of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The InChIKey is VPVTXVHUJHGOCM-UHFFFAOYSA-N.
What is the Canonical SMILES of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The Canonical SMILES is CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C=C2)O)C(C)(C)C3=CC=C(C=C3)O.
What is the CAS number of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl]?
The CAS number is 2300-15-4.
What is the molecular weight of Phenol, 2,4-bis[1-(4-hydroxyphenyl)-1-methylethyl] according to PubChem?
The molecular weight is 362.5 g/mol according to PubChem.
※ Please kindly note that our products are for research use only.