The molecular formula of the keyword is C12H10O4S2.
What is the molecular weight of the keyword?
The molecular weight of the keyword is 282.3 g/mol.
When was the keyword created?
The keyword was created on September 10, 2005.
Can you provide other names or synonyms for the keyword?
Yes, other names or synonyms for the keyword include 2,2',3,3'-tetrahydro-5,5'-bithieno[3,4-b][1,4]dioxine, 2,3-DIHYDRO-5-(2,3-DIHYDROTHIENO[3,4-B][1,4]DIOXIN-5-YL)THIENO[3,4-B][1,4]DIOXINE, and 2,2',3,3'-Tetrahydro-5,5'-bithieno-[3,4-b][1,4]dioxine.
What is the InChI code for the keyword?
The InChI code for the keyword is InChI=1S/C12H10O4S2/c1-3-15-9-7(13-1)5-17-11(9)12-10-8(6-18-12)14-2-4-16-10/h5-6H,1-4H2.
How many hydrogen bond acceptor count does the keyword have?
The keyword has 6 hydrogen bond acceptor count.
What is the XLogP3-AA value of the keyword?
The XLogP3-AA value of the keyword is 2.4.
What is the topological polar surface area of the keyword?
The topological polar surface area of the keyword is 93.4Ų.
How many rotatable bond count does the keyword have?
The keyword has 1 rotatable bond count.
Is the keyword a covalently-bonded unit count?
Yes, the keyword is a covalently-bonded unit count.
※ Please kindly note that our products are for research use only.