What is the molecular formula of D-alpha-hydroxyisovaleric acid?
The molecular formula of D-alpha-hydroxyisovaleric acid is C5H10O3.
What are the synonyms of D-alpha-hydroxyisovaleric acid?
The synonyms of D-alpha-hydroxyisovaleric acid are 17407-56-6, (R)-2-hydroxy-3-methylbutanoic acid, (2R)-2-hydroxy-3-methylbutanoic acid, and (R)-2-hydroxy-3-methylbutyric acid.
What is the molecular weight of D-alpha-hydroxyisovaleric acid?
The molecular weight of D-alpha-hydroxyisovaleric acid is 118.13 g/mol.
What is the IUPAC name of D-alpha-hydroxyisovaleric acid?
The IUPAC name of D-alpha-hydroxyisovaleric acid is (2R)-2-hydroxy-3-methylbutanoic acid.
What is the InChI of D-alpha-hydroxyisovaleric acid?
The InChI of D-alpha-hydroxyisovaleric acid is InChI=1S/C5H10O3/c1-3(2)4(6)5(7)8/h3-4,6H,1-2H3,(H,7,8)/t4-/m1/s1.
How many hydrogen bond donor counts does D-alpha-hydroxyisovaleric acid have?
D-alpha-hydroxyisovaleric acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does D-alpha-hydroxyisovaleric acid have?
D-alpha-hydroxyisovaleric acid has 3 hydrogen bond acceptor counts.
What is the XLogP3-AA value of D-alpha-hydroxyisovaleric acid?
The XLogP3-AA value of D-alpha-hydroxyisovaleric acid is 0.5.
What is the topological polar surface area of D-alpha-hydroxyisovaleric acid?
The topological polar surface area of D-alpha-hydroxyisovaleric acid is 57.5 Ų.
Is D-alpha-hydroxyisovaleric acid a covalently-bonded unit?
Yes, D-alpha-hydroxyisovaleric acid is a covalently-bonded unit.
※ Please kindly note that our products are for research use only.