What is the molecular formula of JTT-501?
The molecular formula of JTT-501 is C22H20N2O5.
What are the synonyms of JTT-501?
The synonyms of JTT-501 are Reglitazar, 170861-63-9, Reglitazar [INN], and P9UTN18JVV.
What is the molecular weight of JTT-501?
The molecular weight of JTT-501 is 392.4 g/mol.
When was JTT-501 created?
JTT-501 was created on June 24, 2005.
Who is developing JTT-501?
JTT-501 is being developed by Pfizer for the treatment of diabetes.
What is the structure of JTT-501?
The structure of JTT-501 can be viewed at the following link: https://pubchem.ncbi.nlm.nih.gov/image/imgsrv.fcgi?cid=154000&t=l
What is the IUPAC name of JTT-501?
The IUPAC name of JTT-501 is 4-[[4-[2-(5-methyl-2-phenyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1,2-oxazolidine-3,5-dione.
What is the InChI of JTT-501?
The InChI of JTT-501 is InChI=1S/C22H20N2O5/c1-14-19(23-21(28-14)16-5-3-2-4-6-16)11-12-27-17-9-7-15(8-10-17)13-18-20(25)24-29-22(18)26/h2-10,18H,11-13H2,1H3,(H,24,25).
What is the InChIKey of JTT-501?
The InChIKey of JTT-501 is QBQLYIISSRXYKL-UHFFFAOYSA-N.
What is the CAS number of JTT-501?
The CAS number of JTT-501 is 170861-63-9.