What is the molecular formula of Methyl 2-Pyridylacetate?
The molecular formula is C8H9NO2.
What are the synonyms for Methyl 2-Pyridylacetate?
The synonyms include methyl 2-(pyridin-2-yl)acetate, 2-Pyridineacetic acid, methyl ester, and 2-Pyridylacetic Acid Methyl Ester.
What is the molecular weight of Methyl 2-Pyridylacetate?
The molecular weight is 151.16 g/mol.
When was Methyl 2-Pyridylacetate created and modified?
It was created on March 26, 2005, and modified on October 21, 2023.
What is the IUPAC name of Methyl 2-Pyridylacetate?
The IUPAC name is methyl 2-pyridin-2-ylacetate.
What is the InChI of Methyl 2-Pyridylacetate?
The InChI is InChI=1S/C8H9NO2/c1-11-8(10)6-7-4-2-3-5-9-7/h2-5H,6H2,1H3.
What is the InChIKey of Methyl 2-Pyridylacetate?
The InChIKey is ORAKNQSHWMHCEY-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 2-Pyridylacetate?
The canonical SMILES is COC(=O)CC1=CC=CC=N1.
What is the CAS number of Methyl 2-Pyridylacetate?
The CAS number is 1658-42-0.
What is the topological polar surface area of Methyl 2-Pyridylacetate?
The topological polar surface area is 39.2 Ų.