The molecular formula of the compound is C27H26N2O5S.
What are the synonyms for the compound?
The synonyms for the compound are 159680-21-4, (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(((2-phenylacetamido)methyl)thio)propanoic acid, 1565818-55-4, Fmoc-L-Cys(Phacm)-OH, N-(((9H-Fluoren-9-yl)methoxy)carbonyl)-S-((2-phenylacetamido)methyl)-D-cysteine.
What is the molecular weight of the compound?
The molecular weight of the compound is 490.6 g/mol.
When was the compound created?
The compound was created on May 31, 2013.
When was the compound last modified?
The compound was last modified on October 21, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[[(2-phenylacetyl)amino]methylsulfanyl]propanoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C27H26N2O5S/c30-25(14-18-8-2-1-3-9-18)28-17-35-16-24(26(31)32)29-27(33)34-15-23-21-12-6-4-10-19(21)20-11-5-7-13-22(20)23/h1-13,23-24H,14-17H2,(H,28,30)(H,29,33)(H,31,32)/t24-/m1/s1.
What is the InChIKey of the compound?
The InChIKey of the compound is UBFAZPXACZPNQB-XMMPIXPASA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1=CC=C(C=C1)CC(=O)NCSCC(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24.
What is the CAS number of the compound?
The CAS number of the compound is 159680-21-4.
※ Please kindly note that our products are for research use only.