What is the molecular formula of 2-Methylnonadecane?
The molecular formula of 2-Methylnonadecane is C20H42.
What are the synonyms for 2-Methylnonadecane?
The synonyms for 2-Methylnonadecane are isoeicosane, 1560-86-7, and nonadecane, 2-methyl-.
What is the molecular weight of 2-Methylnonadecane?
The molecular weight of 2-Methylnonadecane is 282.5 g/mol.
What is the IUPAC name of 2-Methylnonadecane?
The IUPAC name of 2-Methylnonadecane is 2-methylnonadecane.
What is the InChI of 2-Methylnonadecane?
The InChI of 2-Methylnonadecane is InChI=1S/C20H42/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(2)3/h20H,4-19H2,1-3H3.
What is the InChIKey of 2-Methylnonadecane?
The InChIKey of 2-Methylnonadecane is LEEDMQGKBNGPDN-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Methylnonadecane?
The canonical SMILES of 2-Methylnonadecane is CCCCCCCCCCCCCCCCC(C)C.
What is the CAS number of 2-Methylnonadecane?
The CAS number of 2-Methylnonadecane is 1560-86-7.
What is the UNII of 2-Methylnonadecane?
The UNII of 2-Methylnonadecane is AR294KAG3T.
What is the XLogP3-AA value of 2-Methylnonadecane?
The XLogP3-AA value of 2-Methylnonadecane is 10.8.