What is the molecular formula of Diphenyl selenide?
The molecular formula of Diphenyl selenide is C12H10Se.
What is the molecular weight of Diphenyl selenide?
The molecular weight of Diphenyl selenide is 233.18 g/mol.
What is the IUPAC name of Diphenyl selenide?
The IUPAC name of Diphenyl selenide is phenylselanylbenzene.
What is the InChI of Diphenyl selenide?
The InChI of Diphenyl selenide is InChI=1S/C12H10Se/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H.
What is the InChIKey of Diphenyl selenide?
The InChIKey of Diphenyl selenide is ORQWTLCYLDRDHK-UHFFFAOYSA-N.
What is the canonical SMILES of Diphenyl selenide?
The canonical SMILES of Diphenyl selenide is C1=CC=C(C=C1)[Se]C2=CC=CC=C2.
What is the CAS number of Diphenyl selenide?
The CAS number of Diphenyl selenide is 1132-39-4.
What is the European Community (EC) Number of Diphenyl selenide?
The European Community (EC) Number of Diphenyl selenide is 214-474-3.
What is the UNII of Diphenyl selenide?
The UNII of Diphenyl selenide is K6MKC9X9CZ.
Is Diphenyl selenide a canonical compound?
Yes, Diphenyl selenide is a canonical compound.