What is the molecular formula of 2-Hydroxysebacic Acid?
The molecular formula is C10H18O5.
What are the synonyms for 2-Hydroxysebacic Acid?
The synonyms are 2-hydroxydecanedioic acid, 103963-71-9, and decanedioic acid, 2-hydroxy-.
What is the molecular weight of 2-Hydroxysebacic Acid?
The molecular weight is 218.25 g/mol.
When was 2-Hydroxysebacic Acid created?
It was created on August 8, 2005.
What is the IUPAC name of 2-Hydroxysebacic Acid?
The IUPAC name is 2-hydroxydecanedioic acid.
What is the InChI of 2-Hydroxysebacic Acid?
The InChI is "InChI=1S/C10H18O5/c11-8(10(14)15)6-4-2-1-3-5-7-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15)".
What is the InChIKey of 2-Hydroxysebacic Acid?
The InChIKey is "LPIOYESQKJFWPQ-UHFFFAOYSA-N".
What is the canonical SMILES of 2-Hydroxysebacic Acid?
The canonical SMILES is "C(CCCC(C(=O)O)O)CCCC(=O)O".
What is the CAS number of 2-Hydroxysebacic Acid?
The CAS number is 103963-71-9.
What is the melting point of 2-Hydroxysebacic Acid?
The melting point is 118 - 121 °C.