What is the molecular formula of butyl diphenyl phosphate?
The molecular formula of butyl diphenyl phosphate is C16H19O4P.
What are the synonyms for butyl diphenyl phosphate?
The synonyms for butyl diphenyl phosphate are BUTYL DIPHENYL PHOSPHATE, 2752-95-6, Phosphoric acid, butyl diphenyl ester, and A229SJ4C8M.
What is the molecular weight of butyl diphenyl phosphate?
The molecular weight of butyl diphenyl phosphate is 306.29 g/mol.
When was it created and modified?
It was created on March 27, 2005, and last modified on October 21, 2023.
What is the IUPAC name of butyl diphenyl phosphate?
The IUPAC name of butyl diphenyl phosphate is butyl diphenyl phosphate.
What is the InChI of butyl diphenyl phosphate?
The InChI of butyl diphenyl phosphate is InChI=1S/C16H19O4P/c1-2-3-14-18-21(17,19-15-10-6-4-7-11-15)20-16-12-8-5-9-13-16/h4-13H,2-3,14H2,1H3.
What is the InChIKey of butyl diphenyl phosphate?
The InChIKey of butyl diphenyl phosphate is DIBUFQMCUZYQKN-UHFFFAOYSA-N.
What is the canonical SMILES of butyl diphenyl phosphate?
The canonical SMILES of butyl diphenyl phosphate is CCCCOP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2.
What is the CAS number of butyl diphenyl phosphate?
The CAS number of butyl diphenyl phosphate is 2752-95-6.
What is the physical description of butyl diphenyl phosphate?
The physical description of butyl diphenyl phosphate is a liquid.