What is the molecular formula of bryopogonic acid?
The molecular formula of bryopogonic acid is C18H12O9.
What is the molecular weight of bryopogonic acid?
The molecular weight of bryopogonic acid is 372.3 g/mol.
What is the synonyms of bryopogonic acid?
The synonyms of bryopogonic acid are Norstictic acid, 1,3-Dihydro-1,4,10-trihydroxy-5,8-dimethyl-3,7-dioxo-7H-isobenzofuro(4,5-b)(1,4)benzodioxepin-11-carboxaldehyde, and 5,13,17-trihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.0 3,8 .0 14,18 ]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carbaldehyde.
When was bryopogonic acid created?
Bryopogonic acid was created on March 28, 2005.
When was bryopogonic acid last modified?
Bryopogonic acid was last modified on December 30, 2023.
Where is bryopogonic acid found?
Bryopogonic acid is found in Buellia, Dimelaena, and other organisms.
What is the IUPAC name of bryopogonic acid?
The IUPAC name of bryopogonic acid is 5,13,17-trihydroxy-7,12-dimethyl-9,15-dioxo-2,10,16-trioxatetracyclo[9.7.0.0 3,8 .0 14,18 ]octadeca-1(11),3(8),4,6,12,14(18)-hexaene-4-carbaldehyde.
What is the InChI of bryopogonic acid?
The InChI of bryopogonic acid is InChI=1S/C18H12O9/c1-5-3-8(20)7(4-19)14-9(5)16(22)26-13-6(2)12(21)10-11(15(13)25-14)18(24)27-17(10)23/h3-4,18,20-21,24H,1-2H3.
What is the InChIKey of bryopogonic acid?
The InChIKey of bryopogonic acid is IEVVSJFLBYOUCJ-UHFFFAOYSA-N.
What is the Canonical SMILES of bryopogonic acid?
The Canonical SMILES of bryopogonic acid is CC1=CC(=C(C2=C1C(=O)OC3=C(O2)C4=C(C(=C3C)O)C(=O)OC4O)C=O)O.