What is the molecular formula of bromopride?
The molecular formula of bromopride is C14H22BrN3O2.
What is the molecular weight of bromopride?
The molecular weight of bromopride is 344.25 g/mol.
What are the synonyms for bromopride?
The synonyms for bromopride include Artomey, Valopride, and Bromoprida.
What is the IUPAC name of bromopride?
The IUPAC name of bromopride is 4-amino-5-bromo-N-[2-(diethylamino)ethyl]-2-methoxybenzamide.
What is the InChIKey of bromopride?
The InChIKey of bromopride is GIYAQDDTCWHPPL-UHFFFAOYSA-N.
What is the canonical SMILES of bromopride?
The canonical SMILES of bromopride is CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Br.
What is the CAS number of bromopride?
The CAS number of bromopride is 4093-35-0.
What is the UNII number of bromopride?
The UNII number of bromopride is 75473V2YZK.
What is the usage of bromopride?
Bromopride is used as a dopamine antagonist and antiemetic with prokinetic properties similar to metoclopramide. However, it is unavailable in America or the United Kingdom.
Download
