What is the molecular formula of bromopentafluorobenzene?
The molecular formula of bromopentafluorobenzene is C6BrF5.
What is the molecular weight of bromopentafluorobenzene?
The molecular weight of bromopentafluorobenzene is 246.96 g/mol.
What is the IUPAC name of bromopentafluorobenzene?
The IUPAC name of bromopentafluorobenzene is 1-bromo-2,3,4,5,6-pentafluorobenzene.
What is the InChI of bromopentafluorobenzene?
The InChI of bromopentafluorobenzene is InChI=1S/C6BrF5/c7-1-2(8)4(10)6(12)5(11)3(1)9.
What is the InChIKey of bromopentafluorobenzene?
The InChIKey of bromopentafluorobenzene is XEKTVXADUPBFOA-UHFFFAOYSA-N.
What is the canonical SMILES of bromopentafluorobenzene?
The canonical SMILES of bromopentafluorobenzene is C1(=C(C(=C(C(=C1F)F)Br)F)F)F.
What is the CAS number of bromopentafluorobenzene?
The CAS number of bromopentafluorobenzene is 344-04-7.
What is the European Community (EC) number of bromopentafluorobenzene?
The European Community (EC) number of bromopentafluorobenzene is 206-449-0.
What is the ChEMBL ID of bromopentafluorobenzene?
The ChEMBL ID of bromopentafluorobenzene is CHEMBL1231233.
What is the Wikipedia page for bromopentafluorobenzene?
The Wikipedia page for bromopentafluorobenzene is "Bromopentafluorobenzene".