What is the molecular formula of Bromochlorophen?
The molecular formula of Bromochlorophen is C13H8Br2Cl2O2.
What is the molecular weight of Bromochlorophen?
The molecular weight of Bromochlorophen is 426.9 g/mol.
What is the IUPAC name of Bromochlorophen?
The IUPAC name of Bromochlorophen is 2-bromo-6-[(3-bromo-5-chloro-2-hydroxyphenyl)methyl]-4-chlorophenol.
What is the InChIKey of Bromochlorophen?
The InChIKey of Bromochlorophen is TYBHZVUFOINFDV-UHFFFAOYSA-N.
What is the Canonical SMILES of Bromochlorophen?
The Canonical SMILES of Bromochlorophen is C1=C(C=C(C(=C1CC2=C(C(=CC(=C2)Cl)Br)O)O)Br)Cl.
What is the CAS number of Bromochlorophen?
The CAS number of Bromochlorophen is 15435-29-7.
What is the European Community (EC) number of Bromochlorophen?
The European Community (EC) number of Bromochlorophen is 239-446-8.
What is the UNII of Bromochlorophen?
The UNII of Bromochlorophen is 2JZV1D2GW7.
What is the XLogP3-AA value of Bromochlorophen?
The XLogP3-AA value of Bromochlorophen is 5.8.
Is Bromochlorophen a canonicalized compound?
Yes, Bromochlorophen is a canonicalized compound.