What is the PubChem CID of Boldenone acetate?
The PubChem CID of Boldenone acetate is 102247.
What is the molecular formula of Boldenone acetate?
The molecular formula of Boldenone acetate is C21H28O3.
What is the molecular weight of Boldenone acetate?
The molecular weight of Boldenone acetate is 328.4 g/mol.
What is the IUPAC name of Boldenone acetate?
The IUPAC name of Boldenone acetate is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
What is the InChI of Boldenone acetate?
The InChI of Boldenone acetate is InChI=1S/C21H28O3/c1-13(22)24-19-7-6-17-16-5-4-14-12-15(23)8-10-20(14,2)18(16)9-11-21(17,19)3/h8,10,12,16-19H,4-7,9,11H2,1-3H3/t16-,17-,18-,19-,20-,21-/m0/s1.
What is the InChIKey of Boldenone acetate?
The InChIKey of Boldenone acetate is KPCDGGNHYODURF-PXQJOHHUSA-N.
What is the canonical SMILES of Boldenone acetate?
The canonical SMILES of Boldenone acetate is CC(=O)OC1CCC2C1(CCC3C2CCC4=CC(=O)C=CC34C).
What is the CAS number of Boldenone acetate?
The CAS number of Boldenone acetate is 2363-59-9.
What is the European Community (EC) number of Boldenone acetate?
The European Community (EC) number of Boldenone acetate is 219-112-8.
What is the Heavy Atom Count of Boldenone acetate?
The Heavy Atom Count of Boldenone acetate is 24.