What is the molecular formula of Boc-dl-phe-oh?
The molecular formula is C14H19NO4.
What is the molecular weight of Boc-dl-phe-oh?
The molecular weight is 265.30 g/mol.
What is the IUPAC name of Boc-dl-phe-oh?
The IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoic acid.
What is the InChI of Boc-dl-phe-oh?
The InChI is InChI=1S/C14H19NO4/c1-14(2,3)19-13(18)15-11(12(16)17)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17).
What is the InChIKey of Boc-dl-phe-oh?
The InChIKey is ZYJPUMXJBDHSIF-UHFFFAOYSA-N.
What is the canonical SMILES of Boc-dl-phe-oh?
The canonical SMILES is CC(C)(C)OC(=O)NC(CC1=CC=CC=C1)C(=O)O.
What is the CAS number of Boc-dl-phe-oh?
The CAS number is 13734-34-4.
What is the EC number of Boc-dl-phe-oh?
The EC number is 834-373-3.
What is the XLogP3 value of Boc-dl-phe-oh?
The XLogP3 value is 2.2.
Is Boc-dl-phe-oh a canonicalized compound?
Yes, Boc-dl-phe-oh is a canonicalized compound.