What is the molecular formula of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The molecular formula is C16H25BN2O4.
What is the synonym for Boc-5-Aminopyridine-2-boronic acid pinacol ester?
One of the synonyms is tert-Butyl (6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl)carbamate.
What is the molecular weight of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The molecular weight is 320.2 g/mol.
When was Boc-5-Aminopyridine-2-boronic acid pinacol ester created?
It was created on October 30, 2011.
What is the IUPAC name of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The IUPAC name is tert-butyl N-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]carbamate.
What is the InChI key of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The InChI key is FOJRYIYOPLHVMZ-UHFFFAOYSA-N.
What is the canonical SMILES of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=NC=C(C=C2)NC(=O)OC(C)(C)C.
What is the CAS number of Boc-5-Aminopyridine-2-boronic acid pinacol ester?
The CAS number is 1310404-08-0.
How many hydrogen bond donor counts does Boc-5-Aminopyridine-2-boronic acid pinacol ester have?
It has 1 hydrogen bond donor count.
Is Boc-5-Aminopyridine-2-boronic acid pinacol ester canonicalized?
Yes, it is canonicalized according to PubChem.