What is the PubChem CID of Bisphenoxyethanolfluorene?
The PubChem CID of Bisphenoxyethanolfluorene is 3764404.
What is the molecular formula of Bisphenoxyethanolfluorene?
The molecular formula of Bisphenoxyethanolfluorene is C29H26O4.
What is the molecular weight of Bisphenoxyethanolfluorene?
The molecular weight of Bisphenoxyethanolfluorene is 438.5 g/mol.
What is the IUPAC name of Bisphenoxyethanolfluorene?
The IUPAC name of Bisphenoxyethanolfluorene is 2-[4-[9-[4-(2-hydroxyethoxy)phenyl]fluoren-9-yl]phenoxy]ethanol.
What is the InChI of Bisphenoxyethanolfluorene?
The InChI of Bisphenoxyethanolfluorene is InChI=1S/C29H26O4/c30-17-19-32-23-13-9-21(10-14-23)29(22-11-15-24(16-12-22)33-20-18-31)27-7-3-1-5-25(27)26-6-2-4-8-28(26)29/h1-16,30-31H,17-20H2.
What is the InChIKey of Bisphenoxyethanolfluorene?
The InChIKey of Bisphenoxyethanolfluorene is NQXNYVAALXGLQT-UHFFFAOYSA-N.
What is the canonical SMILES of Bisphenoxyethanolfluorene?
The canonical SMILES of Bisphenoxyethanolfluorene is C1=CC=C2C(=C1)C3=CC=CC=C3C2(C4=CC=C(C=C4)OCCO)C5=CC=C(C=C5)OCCO.
What is the CAS number of Bisphenoxyethanolfluorene?
The CAS number of Bisphenoxyethanolfluorene is 117344-32-8.
What is the European Community (EC) number of Bisphenoxyethanolfluorene?
The European Community (EC) number of Bisphenoxyethanolfluorene is 672-704-1.
What is the ChEMBL ID of Bisphenoxyethanolfluorene?
The ChEMBL ID of Bisphenoxyethanolfluorene is CHEMBL336021.
※ Please kindly note that our products are for research use only.