What is the chemical formula of Bicalutamide?
The chemical formula of Bicalutamide is C18H14F4N2O4S.
What is the molecular weight of Bicalutamide?
The molecular weight of Bicalutamide is 430.4 g/mol.
What is the mechanism of action of Bicalutamide?
The mechanism of action of Bicalutamide is as an Androgen Receptor Antagonist.
What is the IUPAC Name of Bicalutamide?
The IUPAC Name of Bicalutamide is N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonyl-2-hydroxy-2-methylpropanamide.
What is the InChIKey of Bicalutamide?
The InChIKey of Bicalutamide is LKJPYSCBVHEWIU-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Bicalutamide?
The Canonical SMILES representation of Bicalutamide is CC(CS(=O)(=O)C1=CC=C(C=C1)F)(C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)O.
What is the CAS number of Bicalutamide?
The CAS number of Bicalutamide is 90357-06-5.
What is the UNII of Bicalutamide?
The UNII of Bicalutamide is A0Z3NAU9DP.
What is the ChEMBL ID of Bicalutamide?
The ChEMBL ID of Bicalutamide is CHEMBL409.
What is the XLogP3-AA value of Bicalutamide?
The XLogP3-AA value of Bicalutamide is 2.3.