What is the PubChem CID of beta-hydroxypyruvic acid lithium salt hydrate?
The PubChem CID of beta-hydroxypyruvic acid lithium salt hydrate is 57369646.
What is the molecular formula of beta-hydroxypyruvic acid lithium salt hydrate?
The molecular formula of beta-hydroxypyruvic acid lithium salt hydrate is C3H5LiO5.
What are the synonyms for beta-hydroxypyruvic acid lithium salt hydrate?
The synonyms for beta-hydroxypyruvic acid lithium salt hydrate include 3-Hydroxypyruvic Acid Lithium Salt, Hydroxypyruvic acid (lithium hydrate), and beta-Hydroxypyruvic acid lithium salt hydrate.
What is the molecular weight of beta-hydroxypyruvic acid lithium salt hydrate?
The molecular weight of beta-hydroxypyruvic acid lithium salt hydrate is 128.0 g/mol.
What is the IUPAC Name of beta-hydroxypyruvic acid lithium salt hydrate?
The IUPAC Name of beta-hydroxypyruvic acid lithium salt hydrate is lithium;3-hydroxy-2-oxopropanoate;hydrate.
What is the InChI of beta-hydroxypyruvic acid lithium salt hydrate?
The InChI of beta-hydroxypyruvic acid lithium salt hydrate is InChI=1S/C3H4O4.Li.H2O/c4-1-2(5)3(6)7;;/h4H,1H2,(H,6,7);;1H2/q;+1;/p-1.
What is the Canonical SMILES of beta-hydroxypyruvic acid lithium salt hydrate?
The Canonical SMILES of beta-hydroxypyruvic acid lithium salt hydrate is [Li+].C(C(=O)C(=O)[O-])O.O.
What is the CAS number of beta-hydroxypyruvic acid lithium salt hydrate?
The CAS number of beta-hydroxypyruvic acid lithium salt hydrate is 3369-79-7.
What is the European Community (EC) Number of beta-hydroxypyruvic acid lithium salt hydrate?
The European Community (EC) Number of beta-hydroxypyruvic acid lithium salt hydrate is 626-797-0.
Is beta-hydroxypyruvic acid lithium salt hydrate a canonicalized compound?
Yes, beta-hydroxypyruvic acid lithium salt hydrate is a canonicalized compound.
※ Please kindly note that our products are for research use only.