What is the molecular formula of Benzyl caprylate?
The molecular formula of Benzyl caprylate is C15H22O2.
What is the molecular weight of Benzyl caprylate?
The molecular weight of Benzyl caprylate is 234.33 g/mol.
What is the IUPAC name of Benzyl caprylate?
The IUPAC name of Benzyl caprylate is benzyl octanoate.
What is the InChI of Benzyl caprylate?
The InChI of Benzyl caprylate is InChI=1S/C15H22O2/c1-2-3-4-5-9-12-15(16)17-13-14-10-7-6-8-11-14/h6-8,10-11H,2-5,9,12-13H2,1H3.
What is the InChIKey of Benzyl caprylate?
The InChIKey of Benzyl caprylate is MWQWCHLIPMDVLS-UHFFFAOYSA-N.
What is the CAS number of Benzyl caprylate?
The CAS number of Benzyl caprylate is 10276-85-4.
What is the XLogP3-AA value of Benzyl caprylate?
The XLogP3-AA value of Benzyl caprylate is 4.6.
How many hydrogen bond donor counts are there in Benzyl caprylate?
There are 0 hydrogen bond donor counts in Benzyl caprylate.
How many hydrogen bond acceptor counts are there in Benzyl caprylate?
There are 2 hydrogen bond acceptor counts in Benzyl caprylate.
How many rotatable bond counts are there in Benzyl caprylate?
There are 9 rotatable bond counts in Benzyl caprylate.