What is the PubChem CID for benzocyclobutene?
The PubChem CID for benzocyclobutene is 69667.
What is the molecular formula of benzocyclobutene?
The molecular formula of benzocyclobutene is C8H8.
What is the molecular weight of benzocyclobutene?
The molecular weight of benzocyclobutene is 104.15 g/mol.
What is the IUPAC name of benzocyclobutene?
The IUPAC name of benzocyclobutene is bicyclo[4.2.0]octa-1,3,5-triene.
What is the InChI of benzocyclobutene?
The InChI of benzocyclobutene is InChI=1S/C8H8/c1-2-4-8-6-5-7(8)3-1/h1-4H,5-6H2.
What is the InChIKey of benzocyclobutene?
The InChIKey of benzocyclobutene is UMIVXZPTRXBADB-UHFFFAOYSA-N.
What is the Canonical SMILES of benzocyclobutene?
The Canonical SMILES of benzocyclobutene is C1CC2=CC=CC=C21.
What is the CAS number of benzocyclobutene?
The CAS number of benzocyclobutene is 694-87-1.
What is the molecular weight of benzocyclobutene according to PubChem?
The molecular weight of benzocyclobutene according to PubChem is 104.15 g/mol.
How many hydrogen bond donor count does benzocyclobutene have?
Benzocyclobutene has 0 hydrogen bond donor count.