What is the molecular formula of Behenyl methacrylate?
The molecular formula of Behenyl methacrylate is C26H50O2.
What are some synonyms for Behenyl methacrylate?
Some synonyms for Behenyl methacrylate include 16669-27-5, Docosyl methacrylate, and Behenyl methacrylate.
What is the molecular weight of Behenyl methacrylate?
The molecular weight of Behenyl methacrylate is 394.7 g/mol.
When was Behenyl methacrylate created and last modified?
Behenyl methacrylate was created on 2005-08-08 and last modified on 2023-12-30.
What is the IUPAC name of Behenyl methacrylate?
The IUPAC name of Behenyl methacrylate is docosyl 2-methylprop-2-enoate.
What is the InChI of Behenyl methacrylate?
The InChI of Behenyl methacrylate is InChI=1S/C26H50O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28-26(27)25(2)3/h2,4-24H2,1,3H3.
How many hydrogen bond donor counts does Behenyl methacrylate have?
Behenyl methacrylate has 0 hydrogen bond donor counts.
What is the exact mass of Behenyl methacrylate?
The exact mass of Behenyl methacrylate is 394.381080833 g/mol.
How many rotatable bond counts does Behenyl methacrylate have?
Behenyl methacrylate has 23 rotatable bond counts.
What is the topological polar surface area of Behenyl methacrylate?
The topological polar surface area of Behenyl methacrylate is 26.3 Ų.